| Names:
|
methyl (1- benzylpiperidin- 2- yl) (phenyl) acetate
(IUPAC)
|
| SMILES: | COC(=O) [C@@H]([C@@H]1CCCCN1Cc2ccccc2) c3ccccc3 |
|---|
| InChI: |
1/C21H25NO2/c1- 24- 21(23) 20(18- 12- 6- 3- 7- 13- 18) 19- 14- 8- 9- 15- 22(19) 16- 17- 10- 4- 2- 5- 11- 17/h2- 7,10- 13,19- 20H,8- 9,14- 16H2,1H3
|
Pubchem
Substances: |
48253955
47657105
|
|---|
| Molecular Weight: | 323.4287 |
|---|
| Rotatable Bonds: | 6 |
|---|
| HBond Acceptors: | 3 |
|---|
| HBond Donors: | 0 |
|---|
| LogP by GhoseCrippen: | 4.299 |
|---|
|
|
| Source |
Library |
Plate |
Well |
Virtual ID |
Pubchem Substance |
Autofluorescence* |
* Autofluorescence testing is performed over a range of excitation
wavelengths using the following
methodology.
