| Names:
|
(1S,2S) - 2- (4,5,6- trihydroxy- 3- oxo- 3H- xanthen- 9- yl) cyclohexanecarboxylic acid
(IUPAC)
|
| SMILES: | OC(=O) [C@H]1CCCC[C@@H]1c2c3ccc(O) c(O) c3oc4c(O) c(=O) ccc24 |
| InChI: |
1/C20H18O7/c21- 13- 7- 5- 11- 15(9- 3- 1- 2- 4- 10(9) 20(25) 26) 12- 6- 8- 14(22) 17(24) 19(12) 27- 18(11) 16(13) 23/h5- 10,21,23- 24H,1- 4H2,(H,25,26) /t9- ,10- /m0/s1
|
Pubchem Substances: |
11458937
11461028
|
| Molecular Weight: | 370.35271 |
| Rotatable Bonds: | 2 |
| HBond Acceptors: | 7 |
| HBond Donors: | 4 |
| LogP by GhoseCrippen: | 2.265 |
|
|
| Source |
Library |
Plate |
Well |
Virtual ID |
Pubchem Substance |
Autofluorescence* |
| NationalInstitutesOfHealth |
NCIStruc1 |
57 |
L21 |
NCIStruc1_001518 |
11458937
|
Not Tested
|
| NationalInstitutesOfHealth |
NCIStruc2 |
856 |
B09 |
NCIStruc2_001627 |
11461028
|
Not Tested
|
* Autofluorescence testing is performed over a range of excitation
wavelengths using the following
methodology.